C41H59FN2O4S — CID 123382580
4-[3a-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]-1-ethenyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]-2-fluorobenzoic acid (PubChem CID 123382580) has the molecular formula C41H59FN2O4S and a molecular weight of 695.00 g/mol. Its IUPAC name is 4-[3a-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]-1-ethenyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]-2-fluorobenzoic acid.
| Compound Name | 4-[3a-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]-1-ethenyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 123382580 |
| Molecular Formula | C41H59FN2O4S |
| Molecular Weight | 695.00 g/mol |
| Exact Mass | 694.42 |
| IUPAC Name | 4-[3a-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethylamino]-1-ethenyl-5a,5b,8,8,11a-pentamethyl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysen-9-yl]-2-fluorobenzoic acid |
| SMILES | C=CC1CCC2(NCCN3CCS(=O)(=O)CC3)CCC3(C)C(CCC4C5(C)CC=C(c6ccc(C(=O)O)c(F)c6)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C41H59FN2O4S/c1-7-27-12-17-41(43-20-21-44-22-24-49(47,48)25-23-44)19-18-39(5)31(35(27)41)10-11-34-38(4)15-13-30(28-8-9-29(36(45)46)32(42)26-28)37(2,3)33(38)14-16-40(34,39)6/h7-9,13,26-27,31,33-35,43H,1,10-12,14-25H2,2-6H3,(H,45,46) |
| InChIKey | USZHURIERBYTDG-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.00 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|