C18H16FNO5 — CID 123382720
methyl 3-(3-fluoro-5-hydroxyphenyl)-2-phenylmethoxycarbonyliminopropanoate (PubChem CID 123382720) has the molecular formula C18H16FNO5 and a molecular weight of 345.33 g/mol. Its IUPAC name is methyl 3-(3-fluoro-5-hydroxyphenyl)-2-phenylmethoxycarbonyliminopropanoate.
| Compound Name | methyl 3-(3-fluoro-5-hydroxyphenyl)-2-phenylmethoxycarbonyliminopropanoate |
|---|---|
| PubChem CID | 123382720 |
| Molecular Formula | C18H16FNO5 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | methyl 3-(3-fluoro-5-hydroxyphenyl)-2-phenylmethoxycarbonyliminopropanoate |
| SMILES | COC(=O)C(Cc1cc(O)cc(F)c1)=NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H16FNO5/c1-24-17(22)16(9-13-7-14(19)10-15(21)8-13)20-18(23)25-11-12-5-3-2-4-6-12/h2-8,10,21H,9,11H2,1H3 |
| InChIKey | HGHVQUZEZJPMKR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|