About 4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one
4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one (PubChem CID 123383007) has the molecular formula C6H9NO3S
and a molecular weight of 175.21 g/mol. Its IUPAC name is 4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one |
| PubChem CID | 123383007 |
| Molecular Formula | C6H9NO3S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | 4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one |
| SMILES | COCCn1c(O)csc1=O |
| InChI | InChI=1S/C6H9NO3S/c1-10-3-2-7-5(8)4-11-6(7)9/h4,8H,2-3H2,1H3 |
| InChIKey | PNEFGLONAHUQQT-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one?
The IUPAC name of 4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one (CID 123383007) is 4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one.
What is the SMILES notation for 4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one?
The canonical SMILES for 4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one is COCCn1c(O)csc1=O.
What is the InChIKey of 4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one?
The InChIKey is PNEFGLONAHUQQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3S/c1-10-3-2-7-5(8)4-11-6(7)9/h4,8H,2-3H2,1H3.
What are the key properties of 4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one?
4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one has a molecular weight of 175.21 g/mol, XLogP of 0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-(2-methoxyethyl)-1,3-thiazol-2-one is sourced from PubChem (CID 123383007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).