C8H13NO2S — CID 106458071
3-(2-propoxyethyl)-1,3-thiazol-2-one (PubChem CID 106458071) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is 3-(2-propoxyethyl)-1,3-thiazol-2-one.
| Compound Name | 3-(2-propoxyethyl)-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106458071 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 3-(2-propoxyethyl)-1,3-thiazol-2-one |
| SMILES | CCCOCCn1ccsc1=O |
| InChI | InChI=1S/C8H13NO2S/c1-2-5-11-6-3-9-4-7-12-8(9)10/h4,7H,2-3,5-6H2,1H3 |
| InChIKey | YTPFDGXGSGLKIP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|