C9H15NO2S — CID 106458070
3-[2-(2-methylpropoxy)ethyl]-1,3-thiazol-2-one (PubChem CID 106458070) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 3-[2-(2-methylpropoxy)ethyl]-1,3-thiazol-2-one.
| Compound Name | 3-[2-(2-methylpropoxy)ethyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 106458070 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 3-[2-(2-methylpropoxy)ethyl]-1,3-thiazol-2-one |
| SMILES | CC(C)COCCn1ccsc1=O |
| InChI | InChI=1S/C9H15NO2S/c1-8(2)7-12-5-3-10-4-6-13-9(10)11/h4,6,8H,3,5,7H2,1-2H3 |
| InChIKey | DVMDVEVRNCJAGP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|