C9H15NO3S — CID 103184191
3-[2-(3-methoxypropoxy)ethyl]-1,3-thiazol-2-one (PubChem CID 103184191) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is 3-[2-(3-methoxypropoxy)ethyl]-1,3-thiazol-2-one.
| Compound Name | 3-[2-(3-methoxypropoxy)ethyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 103184191 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 3-[2-(3-methoxypropoxy)ethyl]-1,3-thiazol-2-one |
| SMILES | COCCCOCCn1ccsc1=O |
| InChI | InChI=1S/C9H15NO3S/c1-12-5-2-6-13-7-3-10-4-8-14-9(10)11/h4,8H,2-3,5-7H2,1H3 |
| InChIKey | UDRRWHNMUXFFOY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|