C10H17NO2S — CID 115749762
3-[2-(3-methylbutoxy)ethyl]-1,3-thiazol-2-one (PubChem CID 115749762) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 3-[2-(3-methylbutoxy)ethyl]-1,3-thiazol-2-one.
| Compound Name | 3-[2-(3-methylbutoxy)ethyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 115749762 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 3-[2-(3-methylbutoxy)ethyl]-1,3-thiazol-2-one |
| SMILES | CC(C)CCOCCn1ccsc1=O |
| InChI | InChI=1S/C10H17NO2S/c1-9(2)3-6-13-7-4-11-5-8-14-10(11)12/h5,8-9H,3-4,6-7H2,1-2H3 |
| InChIKey | PZXGTSCHOUNKAF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|