C10H17NO4S — CID 116622670
3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1,3-thiazol-2-one (PubChem CID 116622670) has the molecular formula C10H17NO4S and a molecular weight of 247.32 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1,3-thiazol-2-one.
| Compound Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 116622670 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-1,3-thiazol-2-one |
| SMILES | COCCOCCOCCn1ccsc1=O |
| InChI | InChI=1S/C10H17NO4S/c1-13-5-6-15-8-7-14-4-2-11-3-9-16-10(11)12/h3,9H,2,4-8H2,1H3 |
| InChIKey | UCXWJDZBHDFBBK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|