C8H13NO3S — CID 115749766
3-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-2-one (PubChem CID 115749766) has the molecular formula C8H13NO3S and a molecular weight of 203.26 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-2-one.
| Compound Name | 3-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 115749766 |
| Molecular Formula | C8H13NO3S |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)ethyl]-1,3-thiazol-2-one |
| SMILES | COCCOCCn1ccsc1=O |
| InChI | InChI=1S/C8H13NO3S/c1-11-5-6-12-4-2-9-3-7-13-8(9)10/h3,7H,2,4-6H2,1H3 |
| InChIKey | SUKGXJVBOMBZPP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|