C30H30ClF2N11O2 — CID 123383104
13-[4-[5-chloro-2-[4-(difluoromethyl)triazol-1-yl]phenyl]-6-oxopyrimidin-1-yl]-9-methyl-3-(triaminomethyl)-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one (PubChem CID 123383104) has the molecular formula C30H30ClF2N11O2 and a molecular weight of 650.09 g/mol. Its IUPAC name is 13-[4-[5-chloro-2-[4-(difluoromethyl)triazol-1-yl]phenyl]-6-oxopyrimidin-1-yl]-9-methyl-3-(triaminomethyl)-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one.
| Compound Name | 13-[4-[5-chloro-2-[4-(difluoromethyl)triazol-1-yl]phenyl]-6-oxopyrimidin-1-yl]-9-methyl-3-(triaminomethyl)-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
|---|---|
| PubChem CID | 123383104 |
| Molecular Formula | C30H30ClF2N11O2 |
| Molecular Weight | 650.09 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | 13-[4-[5-chloro-2-[4-(difluoromethyl)triazol-1-yl]phenyl]-6-oxopyrimidin-1-yl]-9-methyl-3-(triaminomethyl)-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
| SMILES | CC1CCCC(n2cnc(-c3cc(Cl)ccc3-n3cc(C(F)F)nn3)cc2=O)c2cccc(c2)-c2c(cnn2C(N)(N)N)NC1=O |
| InChI | InChI=1S/C30H30ClF2N11O2/c1-16-4-2-7-24(17-5-3-6-18(10-17)27-22(39-29(16)46)13-38-44(27)30(34,35)36)42-15-37-21(12-26(42)45)20-11-19(31)8-9-25(20)43-14-23(28(32)33)40-41-43/h3,5-6,8-16,24,28H,2,4,7,34-36H2,1H3,(H,39,46) |
| InChIKey | GQTBHZAGBPCXIP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 190.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.09 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|