C29H27Cl2F2N7O2 — CID 135192517
13-[4-[2-[[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-(difluoromethyl)-9-methyl-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one (PubChem CID 135192517) has the molecular formula C29H27Cl2F2N7O2 and a molecular weight of 614.48 g/mol. Its IUPAC name is 13-[4-[2-[[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-(difluoromethyl)-9-methyl-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one.
| Compound Name | 13-[4-[2-[[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-(difluoromethyl)-9-methyl-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
|---|---|
| PubChem CID | 135192517 |
| Molecular Formula | C29H27Cl2F2N7O2 |
| Molecular Weight | 614.48 g/mol |
| Exact Mass | 613.16 |
| IUPAC Name | 13-[4-[2-[[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-(difluoromethyl)-9-methyl-3,4,7-triazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
| SMILES | CC1CCCC(n2cnc(-c3cc(Cl)ccc3N/C=C(\N)Cl)cc2=O)c2cccc(c2)-c2c(cnn2C(F)F)NC1=O |
| InChI | InChI=1S/C29H27Cl2F2N7O2/c1-16-4-2-7-24(17-5-3-6-18(10-17)27-23(38-28(16)42)13-37-40(27)29(32)33)39-15-36-22(12-26(39)41)20-11-19(30)8-9-21(20)35-14-25(31)34/h3,5-6,8-16,24,29,35H,2,4,7,34H2,1H3,(H,38,42)/b25-14- |
| InChIKey | RKAXOKRTOVINJD-QFEZKATASA-N |
| XLogP | 6.58 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.48 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|