C31H27ClF4N6O2 — CID 167039089
14-[4-[2-[[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-4-fluoro-10-methyl-5,8-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one (PubChem CID 167039089) has the molecular formula C31H27ClF4N6O2 and a molecular weight of 627.04 g/mol. Its IUPAC name is 14-[4-[2-[[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-4-fluoro-10-methyl-5,8-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one.
| Compound Name | 14-[4-[2-[[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-4-fluoro-10-methyl-5,8-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one |
|---|---|
| PubChem CID | 167039089 |
| Molecular Formula | C31H27ClF4N6O2 |
| Molecular Weight | 627.04 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | 14-[4-[2-[[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-4-fluoro-10-methyl-5,8-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one |
| SMILES | CC1CCCC(n2cnc(-c3cc(Cl)ccc3N/C=C(\N)C(F)(F)F)cc2=O)c2cccc(c2)-c2cc(F)ncc2NC1=O |
| InChI | InChI=1S/C31H27ClF4N6O2/c1-17-4-2-7-26(19-6-3-5-18(10-19)21-12-28(33)39-14-25(21)41-30(17)44)42-16-40-24(13-29(42)43)22-11-20(32)8-9-23(22)38-15-27(37)31(34,35)36/h3,5-6,8-17,26,38H,2,4,7,37H2,1H3,(H,41,44)/b27-15- |
| InChIKey | OHAWQJBXPSNGLS-DICXZTSXSA-N |
| XLogP | 6.89 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.04 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|