C29H27Cl2N7O2 — CID 167038939
14-[4-[2-[[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-10-methyl-3,5,8-triazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one (PubChem CID 167038939) has the molecular formula C29H27Cl2N7O2 and a molecular weight of 576.49 g/mol. Its IUPAC name is 14-[4-[2-[[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-10-methyl-3,5,8-triazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one.
| Compound Name | 14-[4-[2-[[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-10-methyl-3,5,8-triazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one |
|---|---|
| PubChem CID | 167038939 |
| Molecular Formula | C29H27Cl2N7O2 |
| Molecular Weight | 576.49 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | 14-[4-[2-[[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-10-methyl-3,5,8-triazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one |
| SMILES | CC1CCCC(n2cnc(-c3cc(Cl)ccc3N/C=C(\N)Cl)cc2=O)c2cccc(c2)-c2ncncc2NC1=O |
| InChI | InChI=1S/C29H27Cl2N7O2/c1-17-4-2-7-25(18-5-3-6-19(10-18)28-24(37-29(17)40)13-33-15-35-28)38-16-36-23(12-27(38)39)21-11-20(30)8-9-22(21)34-14-26(31)32/h3,5-6,8-17,25,34H,2,4,7,32H2,1H3,(H,37,40)/b26-14- |
| InChIKey | LJECZDVEYPBYGL-WGARJPEWSA-N |
| XLogP | 5.78 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|