C30H28Cl3N7O2 — CID 135192319
14-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-chloro-10-methyl-5,8-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one (PubChem CID 135192319) has the molecular formula C30H28Cl3N7O2 and a molecular weight of 624.96 g/mol. Its IUPAC name is 14-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-chloro-10-methyl-5,8-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one.
| Compound Name | 14-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-chloro-10-methyl-5,8-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one |
|---|---|
| PubChem CID | 135192319 |
| Molecular Formula | C30H28Cl3N7O2 |
| Molecular Weight | 624.96 g/mol |
| Exact Mass | 623.14 |
| IUPAC Name | 14-[4-[2-[amino-[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-chloro-10-methyl-5,8-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-9-one |
| SMILES | CC1CCCC(n2cnc(-c3cc(Cl)ccc3N(N)/C=C(\N)Cl)cc2=O)c2cccc(c2)-c2c(Cl)cncc2NC1=O |
| InChI | InChI=1S/C30H28Cl3N7O2/c1-17-4-2-7-25(18-5-3-6-19(10-18)29-22(32)13-36-14-24(29)38-30(17)42)39-16-37-23(12-28(39)41)21-11-20(31)8-9-26(21)40(35)15-27(33)34/h3,5-6,8-17,25H,2,4,7,34-35H2,1H3,(H,38,42)/b27-15- |
| InChIKey | WZLRAKCZEANHQO-DICXZTSXSA-N |
| XLogP | 6.30 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.96 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|