C28H26Cl2F2N8O2 — CID 167015149
13-[4-[2-[[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-(difluoromethyl)-9-methyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one (PubChem CID 167015149) has the molecular formula C28H26Cl2F2N8O2 and a molecular weight of 615.47 g/mol. Its IUPAC name is 13-[4-[2-[[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-(difluoromethyl)-9-methyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one.
| Compound Name | 13-[4-[2-[[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-(difluoromethyl)-9-methyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
|---|---|
| PubChem CID | 167015149 |
| Molecular Formula | C28H26Cl2F2N8O2 |
| Molecular Weight | 615.47 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | 13-[4-[2-[[(E)-2-amino-2-chloroethenyl]amino]-5-chlorophenyl]-6-oxopyrimidin-1-yl]-3-(difluoromethyl)-9-methyl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
| SMILES | CC1CCCC(n2cnc(-c3cc(Cl)ccc3N/C=C(\N)Cl)cc2=O)c2cc(ccn2)-c2c(cnn2C(F)F)NC1=O |
| InChI | InChI=1S/C28H26Cl2F2N8O2/c1-15-3-2-4-23(21-9-16(7-8-34-21)26-22(38-27(15)42)12-37-40(26)28(31)32)39-14-36-20(11-25(39)41)18-10-17(29)5-6-19(18)35-13-24(30)33/h5-15,23,28,35H,2-4,33H2,1H3,(H,38,42)/b24-13- |
| InChIKey | DMIKHFBHVGMVJA-CFRMEGHHSA-N |
| XLogP | 5.97 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|