C30H31Cl2FN8O2 — CID 144897759
13-[4-[6-[[(E)-2-amino-2-chloroethenyl]amino]-3-chloro-2-fluorophenyl]-6-oxopyrimidin-1-yl]-3-methyl-9-propan-2-yl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one (PubChem CID 144897759) has the molecular formula C30H31Cl2FN8O2 and a molecular weight of 625.54 g/mol. Its IUPAC name is 13-[4-[6-[[(E)-2-amino-2-chloroethenyl]amino]-3-chloro-2-fluorophenyl]-6-oxopyrimidin-1-yl]-3-methyl-9-propan-2-yl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one.
| Compound Name | 13-[4-[6-[[(E)-2-amino-2-chloroethenyl]amino]-3-chloro-2-fluorophenyl]-6-oxopyrimidin-1-yl]-3-methyl-9-propan-2-yl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
|---|---|
| PubChem CID | 144897759 |
| Molecular Formula | C30H31Cl2FN8O2 |
| Molecular Weight | 625.54 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | 13-[4-[6-[[(E)-2-amino-2-chloroethenyl]amino]-3-chloro-2-fluorophenyl]-6-oxopyrimidin-1-yl]-3-methyl-9-propan-2-yl-3,4,7,15-tetrazatricyclo[12.3.1.02,6]octadeca-1(18),2(6),4,14,16-pentaen-8-one |
| SMILES | CC(C)C1CCCC(n2cnc(-c3c(N/C=C(\N)Cl)ccc(Cl)c3F)cc2=O)c2cc(ccn2)-c2c(cnn2C)NC1=O |
| InChI | InChI=1S/C30H31Cl2FN8O2/c1-16(2)18-5-4-6-24(21-11-17(9-10-35-21)29-23(39-30(18)43)13-38-40(29)3)41-15-37-22(12-26(41)42)27-20(36-14-25(32)34)8-7-19(31)28(27)33/h7-16,18,24,36H,4-6,34H2,1-3H3,(H,39,43)/b25-14- |
| InChIKey | QUPKQDSVECGKPK-QFEZKATASA-N |
| XLogP | 5.89 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|