About 1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium
1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium (PubChem CID 123384014) has the molecular formula C17H26N+
and a molecular weight of 244.40 g/mol. Its IUPAC name is 1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium.
Molecular Properties
| Compound Name | 1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium |
| PubChem CID | 123384014 |
| Molecular Formula | C17H26N+ |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.21 |
| IUPAC Name | 1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium |
| SMILES | CC=CC1CC1C1=CCC(=CC(C)C)C[N+](C)=C1 |
| InChI | InChI=1S/C17H26N/c1-5-6-15-10-17(15)16-8-7-14(9-13(2)3)11-18(4)12-16/h5-6,8-9,12-13,15,17H,7,10-11H2,1-4H3/q+1 |
| InChIKey | SGMGVDGFYCTIDD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium?
The IUPAC name of 1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium (CID 123384014) is 1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium.
What is the SMILES notation for 1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium?
The canonical SMILES for 1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium is CC=CC1CC1C1=CCC(=CC(C)C)C[N+](C)=C1.
What is the InChIKey of 1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium?
The InChIKey is SGMGVDGFYCTIDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N/c1-5-6-15-10-17(15)16-8-7-14(9-13(2)3)11-18(4)12-16/h5-6,8-9,12-13,15,17H,7,10-11H2,1-4H3/q+1.
What are the key properties of 1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium?
1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium has a molecular weight of 244.40 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(2-methylpropylidene)-6-(2-prop-1-enylcyclopropyl)-2,4-dihydroazepin-1-ium is sourced from PubChem (CID 123384014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).