C20H29N — CID 143387337
(E)-N-butyl-2-methyl-3-[2-[(2E,4E)-6-methylideneocta-2,4,7-trien-2-yl]cyclopropyl]prop-2-en-1-imine (PubChem CID 143387337) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is (E)-N-butyl-2-methyl-3-[2-[(2E,4E)-6-methylideneocta-2,4,7-trien-2-yl]cyclopropyl]prop-2-en-1-imine.
| Compound Name | (E)-N-butyl-2-methyl-3-[2-[(2E,4E)-6-methylideneocta-2,4,7-trien-2-yl]cyclopropyl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 143387337 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | (E)-N-butyl-2-methyl-3-[2-[(2E,4E)-6-methylideneocta-2,4,7-trien-2-yl]cyclopropyl]prop-2-en-1-imine |
| SMILES | C=CC(=C)/C=C/C=C(\C)C1CC1/C=C(C)/C=N/CCCC |
| InChI | InChI=1S/C20H29N/c1-6-8-12-21-15-17(4)13-19-14-20(19)18(5)11-9-10-16(3)7-2/h7,9-11,13,15,19-20H,2-3,6,8,12,14H2,1,4-5H3/b10-9+,17-13+,18-11+,21-15+ |
| InChIKey | FYIOVOYYQPNIGQ-VTPHCRLGSA-N |
| XLogP | 5.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|