C17H31N — CID 123920709
N,4-dimethyl-2-(3-methylbutan-2-yl)-3-propylhepta-2,4-dien-1-imine (PubChem CID 123920709) has the molecular formula C17H31N and a molecular weight of 249.44 g/mol. Its IUPAC name is N,4-dimethyl-2-(3-methylbutan-2-yl)-3-propylhepta-2,4-dien-1-imine.
| Compound Name | N,4-dimethyl-2-(3-methylbutan-2-yl)-3-propylhepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123920709 |
| Molecular Formula | C17H31N |
| Molecular Weight | 249.44 g/mol |
| Exact Mass | 249.25 |
| IUPAC Name | N,4-dimethyl-2-(3-methylbutan-2-yl)-3-propylhepta-2,4-dien-1-imine |
| SMILES | CCC=C(C)C(CCC)=C(/C=N/C)C(C)C(C)C |
| InChI | InChI=1S/C17H31N/c1-8-10-14(5)16(11-9-2)17(12-18-7)15(6)13(3)4/h10,12-13,15H,8-9,11H2,1-7H3/b14-10?,17-16?,18-12+ |
| InChIKey | HWAMPTJEFPDDBW-MIOMRCIHSA-N |
| XLogP | 5.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|