C18H35N — CID 123756222
(Z)-N-butyl-4,5,6-trimethyl-2-propan-2-yloct-2-en-1-imine (PubChem CID 123756222) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is (Z)-N-butyl-4,5,6-trimethyl-2-propan-2-yloct-2-en-1-imine.
| Compound Name | (Z)-N-butyl-4,5,6-trimethyl-2-propan-2-yloct-2-en-1-imine |
|---|---|
| PubChem CID | 123756222 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | (Z)-N-butyl-4,5,6-trimethyl-2-propan-2-yloct-2-en-1-imine |
| SMILES | CCCC/N=C/C(=C\C(C)C(C)C(C)CC)C(C)C |
| InChI | InChI=1S/C18H35N/c1-8-10-11-19-13-18(14(3)4)12-16(6)17(7)15(5)9-2/h12-17H,8-11H2,1-7H3/b18-12+,19-13+ |
| InChIKey | TZUKDEFTIIMUPD-KLCVKJMQSA-N |
| XLogP | 5.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|