C11H19N — CID 91332411
2-butan-2-yl-2,5-dimethyl-3H-pyridine (PubChem CID 91332411) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 2-butan-2-yl-2,5-dimethyl-3H-pyridine.
| Compound Name | 2-butan-2-yl-2,5-dimethyl-3H-pyridine |
|---|---|
| PubChem CID | 91332411 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2-butan-2-yl-2,5-dimethyl-3H-pyridine |
| SMILES | CCC(C)C1(C)CC=C(C)C=N1 |
| InChI | InChI=1S/C11H19N/c1-5-10(3)11(4)7-6-9(2)8-12-11/h6,8,10H,5,7H2,1-4H3 |
| InChIKey | HUXSTEJCCACFCU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |