C21H31N — CID 123704449
(Z)-N-(2-ethyl-4-ethylidene-3-methylnon-5-en-8-ynyl)-2-prop-1-en-2-ylbut-2-en-1-imine (PubChem CID 123704449) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (Z)-N-(2-ethyl-4-ethylidene-3-methylnon-5-en-8-ynyl)-2-prop-1-en-2-ylbut-2-en-1-imine.
| Compound Name | (Z)-N-(2-ethyl-4-ethylidene-3-methylnon-5-en-8-ynyl)-2-prop-1-en-2-ylbut-2-en-1-imine |
|---|---|
| PubChem CID | 123704449 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (Z)-N-(2-ethyl-4-ethylidene-3-methylnon-5-en-8-ynyl)-2-prop-1-en-2-ylbut-2-en-1-imine |
| SMILES | C#CCC=CC(=CC)C(C)C(CC)C/N=C/C(=C\C)C(=C)C |
| InChI | InChI=1S/C21H31N/c1-8-12-13-14-19(9-2)18(7)21(11-4)16-22-15-20(10-3)17(5)6/h1,9-10,13-15,18,21H,5,11-12,16H2,2-4,6-7H3/b14-13?,19-9?,20-10+,22-15+ |
| InChIKey | QXHAYGQVMGRRRW-MVTPZENVSA-N |
| XLogP | 5.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|