C16H27N — CID 153397887
ethene;(5E,6Z)-5-ethylidene-4,6-dimethyl-7-propan-2-yl-3,4-dihydro-2H-azocine (PubChem CID 153397887) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is ethene;(5E,6Z)-5-ethylidene-4,6-dimethyl-7-propan-2-yl-3,4-dihydro-2H-azocine.
| Compound Name | ethene;(5E,6Z)-5-ethylidene-4,6-dimethyl-7-propan-2-yl-3,4-dihydro-2H-azocine |
|---|---|
| PubChem CID | 153397887 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | ethene;(5E,6Z)-5-ethylidene-4,6-dimethyl-7-propan-2-yl-3,4-dihydro-2H-azocine |
| SMILES | C/C=C1C(/C)=C(C(C)C)\C=N/CCC/1C.C=C |
| InChI | InChI=1S/C14H23N.C2H4/c1-6-13-11(4)7-8-15-9-14(10(2)3)12(13)5;1-2/h6,9-11H,7-8H2,1-5H3;1-2H2/b13-6+,14-12+,15-9-; |
| InChIKey | DONSTQVIZGGBTK-AMHGJXFPSA-N |
| XLogP | 4.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|