C22H35N — CID 123200197
4-(5,5-diethyl-6,9-dimethylcyclonona-1,6-dien-1-yl)-N-methyl-2-methylidenepent-3-en-1-imine (PubChem CID 123200197) has the molecular formula C22H35N and a molecular weight of 313.53 g/mol. Its IUPAC name is 4-(5,5-diethyl-6,9-dimethylcyclonona-1,6-dien-1-yl)-N-methyl-2-methylidenepent-3-en-1-imine.
| Compound Name | 4-(5,5-diethyl-6,9-dimethylcyclonona-1,6-dien-1-yl)-N-methyl-2-methylidenepent-3-en-1-imine |
|---|---|
| PubChem CID | 123200197 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | 4-(5,5-diethyl-6,9-dimethylcyclonona-1,6-dien-1-yl)-N-methyl-2-methylidenepent-3-en-1-imine |
| SMILES | C=C(C=C(C)C1=CCCC(CC)(CC)C(C)=CCC1C)/C=N/C |
| InChI | InChI=1S/C22H35N/c1-8-22(9-2)14-10-11-21(18(4)12-13-20(22)6)19(5)15-17(3)16-23-7/h11,13,15-16,18H,3,8-10,12,14H2,1-2,4-7H3/b19-15?,20-13?,21-11?,23-16+ |
| InChIKey | IEARGAFERHRMBI-DJPOZCMSSA-N |
| XLogP | 6.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|