C20H35N — CID 91579874
N-[3-(2-ethylcyclopropylidene)-2-methylprop-1-enyl]-2,3,3,5,5-pentamethylhexan-1-imine (PubChem CID 91579874) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is N-[3-(2-ethylcyclopropylidene)-2-methylprop-1-enyl]-2,3,3,5,5-pentamethylhexan-1-imine.
| Compound Name | N-[3-(2-ethylcyclopropylidene)-2-methylprop-1-enyl]-2,3,3,5,5-pentamethylhexan-1-imine |
|---|---|
| PubChem CID | 91579874 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N-[3-(2-ethylcyclopropylidene)-2-methylprop-1-enyl]-2,3,3,5,5-pentamethylhexan-1-imine |
| SMILES | CCC1CC1=CC(C)=C/N=C/C(C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H35N/c1-9-17-11-18(17)10-15(2)12-21-13-16(3)20(7,8)14-19(4,5)6/h10,12-13,16-17H,9,11,14H2,1-8H3/b15-12?,18-10?,21-13+ |
| InChIKey | PPMURKFNXDNXPR-KUWKSNRTSA-N |
| XLogP | 6.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|