C16H27N — CID 145300701
3,3-dimethyl-6-(2,4,4-trimethylpentan-2-yl)azepine (PubChem CID 145300701) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 3,3-dimethyl-6-(2,4,4-trimethylpentan-2-yl)azepine.
| Compound Name | 3,3-dimethyl-6-(2,4,4-trimethylpentan-2-yl)azepine |
|---|---|
| PubChem CID | 145300701 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 3,3-dimethyl-6-(2,4,4-trimethylpentan-2-yl)azepine |
| SMILES | CC1(C)C=CC(C(C)(C)CC(C)(C)C)=CN=C1 |
| InChI | InChI=1S/C16H27N/c1-14(2,3)11-16(6,7)13-8-9-15(4,5)12-17-10-13/h8-10,12H,11H2,1-7H3 |
| InChIKey | QRZIUBJTYOLWNL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |