C25H35N — CID 143619682
5-[2-[(6Z)-cycloocta-3,6-dien-1-yl]propan-2-yl]-3H-azepine;(3Z,5Z)-octa-1,3,5-triene (PubChem CID 143619682) has the molecular formula C25H35N and a molecular weight of 349.56 g/mol. Its IUPAC name is 5-[2-[(6Z)-cycloocta-3,6-dien-1-yl]propan-2-yl]-3H-azepine;(3Z,5Z)-octa-1,3,5-triene.
| Compound Name | 5-[2-[(6Z)-cycloocta-3,6-dien-1-yl]propan-2-yl]-3H-azepine;(3Z,5Z)-octa-1,3,5-triene |
|---|---|
| PubChem CID | 143619682 |
| Molecular Formula | C25H35N |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | 5-[2-[(6Z)-cycloocta-3,6-dien-1-yl]propan-2-yl]-3H-azepine;(3Z,5Z)-octa-1,3,5-triene |
| SMILES | C=C/C=C\C=C/CC.CC(C)(C1=CCC=NC=C1)C1CC=CC/C=C\C1 |
| InChI | InChI=1S/C17H23N.C8H12/c1-17(2,16-11-8-13-18-14-12-16)15-9-6-4-3-5-7-10-15;1-3-5-7-8-6-4-2/h4-7,11-15H,3,8-10H2,1-2H3;3,5-8H,1,4H2,2H3/b6-4-,7-5?;7-5-,8-6- |
| InChIKey | VNRJNFBVAKPVOS-VQZQRYLLSA-N |
| XLogP | 7.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|