C25H41N — CID 123355380
N-[3-[(2-cyclohexa-2,4-dien-1-ylcyclopropyl)methyl]-5-propyloct-1-enyl]-2-methylpropan-1-imine (PubChem CID 123355380) has the molecular formula C25H41N and a molecular weight of 355.61 g/mol. Its IUPAC name is N-[3-[(2-cyclohexa-2,4-dien-1-ylcyclopropyl)methyl]-5-propyloct-1-enyl]-2-methylpropan-1-imine.
| Compound Name | N-[3-[(2-cyclohexa-2,4-dien-1-ylcyclopropyl)methyl]-5-propyloct-1-enyl]-2-methylpropan-1-imine |
|---|---|
| PubChem CID | 123355380 |
| Molecular Formula | C25H41N |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.32 |
| IUPAC Name | N-[3-[(2-cyclohexa-2,4-dien-1-ylcyclopropyl)methyl]-5-propyloct-1-enyl]-2-methylpropan-1-imine |
| SMILES | CCCC(CCC)CC(C=C/N=C/C(C)C)CC1CC1C1C=CC=CC1 |
| InChI | InChI=1S/C25H41N/c1-5-10-21(11-6-2)16-22(14-15-26-19-20(3)4)17-24-18-25(24)23-12-8-7-9-13-23/h7-9,12,14-15,19-25H,5-6,10-11,13,16-18H2,1-4H3/b15-14?,26-19+ |
| InChIKey | NZZGQRQJEWSJAB-GPWOTLNDSA-N |
| XLogP | 7.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|