C19H27N — CID 123737093
3-ethenyl-2-ethyl-N-(4-methylnona-4,6-dien-8-ynyl)pent-4-en-1-imine (PubChem CID 123737093) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 3-ethenyl-2-ethyl-N-(4-methylnona-4,6-dien-8-ynyl)pent-4-en-1-imine.
| Compound Name | 3-ethenyl-2-ethyl-N-(4-methylnona-4,6-dien-8-ynyl)pent-4-en-1-imine |
|---|---|
| PubChem CID | 123737093 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 3-ethenyl-2-ethyl-N-(4-methylnona-4,6-dien-8-ynyl)pent-4-en-1-imine |
| SMILES | C#CC=CC=C(C)CCC/N=C/C(CC)C(C=C)C=C |
| InChI | InChI=1S/C19H27N/c1-6-10-11-13-17(5)14-12-15-20-16-19(9-4)18(7-2)8-3/h1,7-8,10-11,13,16,18-19H,2-3,9,12,14-15H2,4-5H3/b11-10?,17-13?,20-16+ |
| InChIKey | OYCLKOSOZCXLEL-CFXCJDEASA-N |
| XLogP | 4.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|