C22H39N — CID 177235104
(4Z,6Z)-10-methyl-8-methylidenedodeca-4,6-diene;(Z)-N-methyl-2-propan-2-ylbut-2-en-1-imine (PubChem CID 177235104) has the molecular formula C22H39N and a molecular weight of 317.56 g/mol. Its IUPAC name is (4Z,6Z)-10-methyl-8-methylidenedodeca-4,6-diene;(Z)-N-methyl-2-propan-2-ylbut-2-en-1-imine.
| Compound Name | (4Z,6Z)-10-methyl-8-methylidenedodeca-4,6-diene;(Z)-N-methyl-2-propan-2-ylbut-2-en-1-imine |
|---|---|
| PubChem CID | 177235104 |
| Molecular Formula | C22H39N |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 317.31 |
| IUPAC Name | (4Z,6Z)-10-methyl-8-methylidenedodeca-4,6-diene;(Z)-N-methyl-2-propan-2-ylbut-2-en-1-imine |
| SMILES | C/C=C(\C=N\C)C(C)C.C=C(/C=C\C=C/CCC)CC(C)CC |
| InChI | InChI=1S/C14H24.C8H15N/c1-5-7-8-9-10-11-14(4)12-13(3)6-2;1-5-8(6-9-4)7(2)3/h8-11,13H,4-7,12H2,1-3H3;5-7H,1-4H3/b9-8-,11-10-;8-5+,9-6+ |
| InChIKey | SRYMORDWYYIXNQ-XOUSWJJBSA-N |
| XLogP | 7.18 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|