About 5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine
5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine (PubChem CID 123384783) has the molecular formula C14H17N3
and a molecular weight of 227.31 g/mol. Its IUPAC name is 5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine.
Molecular Properties
| Compound Name | 5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine |
| PubChem CID | 123384783 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine |
| SMILES | CC=c1nccc(C2=CN(C)N=CC2)/c1=C/C |
| InChI | InChI=1S/C14H17N3/c1-4-12-13(7-8-15-14(12)5-2)11-6-9-16-17(3)10-11/h4-5,7-10H,6H2,1-3H3/b12-4-,14-5? |
| InChIKey | BGXDLVRJTRJDFB-IAAZDDHTSA-N |
| XLogP | 1.34 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine?
The IUPAC name of 5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine (CID 123384783) is 5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine.
What is the SMILES notation for 5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine?
The canonical SMILES for 5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine is CC=c1nccc(C2=CN(C)N=CC2)/c1=C/C.
What is the InChIKey of 5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine?
The InChIKey is BGXDLVRJTRJDFB-IAAZDDHTSA-N. The full InChI is InChI=1S/C14H17N3/c1-4-12-13(7-8-15-14(12)5-2)11-6-9-16-17(3)10-11/h4-5,7-10H,6H2,1-3H3/b12-4-,14-5?.
What are the key properties of 5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine?
5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine has a molecular weight of 227.31 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3Z)-2,3-di(ethylidene)-4-pyridinyl]-1-methyl-4H-pyridazine is sourced from PubChem (CID 123384783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).