C12H16N2 — CID 91443773
ethane;5-methyl-6-methylidenepyrido[1,2-b]pyridazine (PubChem CID 91443773) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is ethane;5-methyl-6-methylidenepyrido[1,2-b]pyridazine.
| Compound Name | ethane;5-methyl-6-methylidenepyrido[1,2-b]pyridazine |
|---|---|
| PubChem CID | 91443773 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | ethane;5-methyl-6-methylidenepyrido[1,2-b]pyridazine |
| SMILES | C=C1C=CN2N=CC=CC2=C1C.CC |
| InChI | InChI=1S/C10H10N2.C2H6/c1-8-5-7-12-10(9(8)2)4-3-6-11-12;1-2/h3-7H,1H2,2H3;1-2H3 |
| InChIKey | RXKTZFUKCIRMSY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |