C9H9ClN2 — CID 123565472
2-chloro-5-methyl-6H-pyrido[1,2-b]pyridazine (PubChem CID 123565472) has the molecular formula C9H9ClN2 and a molecular weight of 180.64 g/mol. Its IUPAC name is 2-chloro-5-methyl-6H-pyrido[1,2-b]pyridazine.
| Compound Name | 2-chloro-5-methyl-6H-pyrido[1,2-b]pyridazine |
|---|---|
| PubChem CID | 123565472 |
| Molecular Formula | C9H9ClN2 |
| Molecular Weight | 180.64 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-chloro-5-methyl-6H-pyrido[1,2-b]pyridazine |
| SMILES | CC1=C2C=CC(Cl)=NN2C=CC1 |
| InChI | InChI=1S/C9H9ClN2/c1-7-3-2-6-12-8(7)4-5-9(10)11-12/h2,4-6H,3H2,1H3 |
| InChIKey | ZSSCUOWJVIRXBA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.64 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |