C14H19ClN2 — CID 123884752
2-chloro-N-(4-methylhepta-1,4,6-trien-3-ylideneamino)-N-prop-1-en-2-ylprop-1-en-1-amine (PubChem CID 123884752) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is 2-chloro-N-(4-methylhepta-1,4,6-trien-3-ylideneamino)-N-prop-1-en-2-ylprop-1-en-1-amine.
| Compound Name | 2-chloro-N-(4-methylhepta-1,4,6-trien-3-ylideneamino)-N-prop-1-en-2-ylprop-1-en-1-amine |
|---|---|
| PubChem CID | 123884752 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-chloro-N-(4-methylhepta-1,4,6-trien-3-ylideneamino)-N-prop-1-en-2-ylprop-1-en-1-amine |
| SMILES | C=CC=C(C)C(C=C)=NN(C=C(C)Cl)C(=C)C |
| InChI | InChI=1S/C14H19ClN2/c1-7-9-12(5)14(8-2)16-17(11(3)4)10-13(6)15/h7-10H,1-3H2,4-6H3 |
| InChIKey | USBMLJZFPDDHDR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|