About 2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine
2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine (PubChem CID 123682772) has the molecular formula C10H11ClN2
and a molecular weight of 194.66 g/mol. Its IUPAC name is 2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine.
Analyze 2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine?
The IUPAC name of 2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine (CID 123682772) is 2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine.
What is the SMILES notation for 2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine?
The canonical SMILES for 2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine is CC1C=CN2N=C(Cl)C=CC2=CC1.
What is the InChIKey of 2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine?
The InChIKey is IMCRLUVFKOZXLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2/c1-8-2-3-9-4-5-10(11)12-13(9)7-6-8/h3-8H,2H2,1H3.
What are the key properties of 2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine?
2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine has a molecular weight of 194.66 g/mol, XLogP of 2.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine is sourced from PubChem (CID 123682772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).