C10H10BrClN2 — CID 123232977
9-bromo-2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine (PubChem CID 123232977) has the molecular formula C10H10BrClN2 and a molecular weight of 273.56 g/mol. Its IUPAC name is 9-bromo-2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine.
| Compound Name | 9-bromo-2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine |
|---|---|
| PubChem CID | 123232977 |
| Molecular Formula | C10H10BrClN2 |
| Molecular Weight | 273.56 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 9-bromo-2-chloro-7-methyl-6,7-dihydropyridazino[1,6-a]azepine |
| SMILES | CC1C=C(Br)N2N=C(Cl)C=CC2=CC1 |
| InChI | InChI=1S/C10H10BrClN2/c1-7-2-3-8-4-5-10(12)13-14(8)9(11)6-7/h3-7H,2H2,1H3 |
| InChIKey | ANVMKKAGIGCZMQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|