C11H16N2 — CID 91480402
2-hepta-3,5-dien-3-yl-3H-pyridazine (PubChem CID 91480402) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-hepta-3,5-dien-3-yl-3H-pyridazine.
| Compound Name | 2-hepta-3,5-dien-3-yl-3H-pyridazine |
|---|---|
| PubChem CID | 91480402 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-hepta-3,5-dien-3-yl-3H-pyridazine |
| SMILES | CC=CC=C(CC)N1CC=CC=N1 |
| InChI | InChI=1S/C11H16N2/c1-3-5-8-11(4-2)13-10-7-6-9-12-13/h3,5-9H,4,10H2,1-2H3 |
| InChIKey | LJXRTJMDNJZVQC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|