C16H28N2 — CID 123469461
N-(butylideneamino)-N,4,7-trimethylnona-2,4,6-trien-3-amine (PubChem CID 123469461) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N-(butylideneamino)-N,4,7-trimethylnona-2,4,6-trien-3-amine.
| Compound Name | N-(butylideneamino)-N,4,7-trimethylnona-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 123469461 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-(butylideneamino)-N,4,7-trimethylnona-2,4,6-trien-3-amine |
| SMILES | CC=C(C(C)=CC=C(C)CC)N(C)N=CCCC |
| InChI | InChI=1S/C16H28N2/c1-7-10-13-17-18(6)16(9-3)15(5)12-11-14(4)8-2/h9,11-13H,7-8,10H2,1-6H3 |
| InChIKey | BXFJAIRBQROEFM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|