C17H31N2+ — CID 123971553
(butylideneamino)-ethyl-methyl-(6-methylidenenona-2,4-dien-3-yl)azanium (PubChem CID 123971553) has the molecular formula C17H31N2+ and a molecular weight of 263.45 g/mol. Its IUPAC name is (butylideneamino)-ethyl-methyl-(6-methylidenenona-2,4-dien-3-yl)azanium.
| Compound Name | (butylideneamino)-ethyl-methyl-(6-methylidenenona-2,4-dien-3-yl)azanium |
|---|---|
| PubChem CID | 123971553 |
| Molecular Formula | C17H31N2+ |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.25 |
| IUPAC Name | (butylideneamino)-ethyl-methyl-(6-methylidenenona-2,4-dien-3-yl)azanium |
| SMILES | C=C(C=CC(=CC)[N+](C)(CC)N=CCCC)CCC |
| InChI | InChI=1S/C17H31N2/c1-7-11-15-18-19(6,10-4)17(9-3)14-13-16(5)12-8-2/h9,13-15H,5,7-8,10-12H2,1-4,6H3/q+1 |
| InChIKey | BEKLQWVGWSACEW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|