C9H11N2+ — CID 123739840
9-methyl-3H-pyrido[1,2-b]pyridazin-9-ium (PubChem CID 123739840) has the molecular formula C9H11N2+ and a molecular weight of 147.20 g/mol. Its IUPAC name is 9-methyl-3H-pyrido[1,2-b]pyridazin-9-ium.
| Compound Name | 9-methyl-3H-pyrido[1,2-b]pyridazin-9-ium |
|---|---|
| PubChem CID | 123739840 |
| Molecular Formula | C9H11N2+ |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | 9-methyl-3H-pyrido[1,2-b]pyridazin-9-ium |
| SMILES | C[N+]12C=CC=CC1=CCC=N2 |
| InChI | InChI=1S/C9H11N2/c1-11-8-3-2-5-9(11)6-4-7-10-11/h2-3,5-8H,4H2,1H3/q+1 |
| InChIKey | FVHBGMXCFKPMRJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|