C15H28N2 — CID 142875403
(2Z,4Z)-N-ethenyl-N-[(Z)-ethylideneamino]hepta-2,4-dien-4-amine;2-methylpropane (PubChem CID 142875403) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (2Z,4Z)-N-ethenyl-N-[(Z)-ethylideneamino]hepta-2,4-dien-4-amine;2-methylpropane.
| Compound Name | (2Z,4Z)-N-ethenyl-N-[(Z)-ethylideneamino]hepta-2,4-dien-4-amine;2-methylpropane |
|---|---|
| PubChem CID | 142875403 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (2Z,4Z)-N-ethenyl-N-[(Z)-ethylideneamino]hepta-2,4-dien-4-amine;2-methylpropane |
| SMILES | C=CN(/N=C\C)C(/C=C\C)=C\CC.CC(C)C |
| InChI | InChI=1S/C11H18N2.C4H10/c1-5-9-11(10-6-2)13(8-4)12-7-3;1-4(2)3/h5,7-10H,4,6H2,1-3H3;4H,1-3H3/b9-5-,11-10-,12-7-; |
| InChIKey | JXHOAVQZHAHVSZ-HKVDPYFBSA-N |
| XLogP | 4.97 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|