C18H22F3N3O4S — CID 123386666
3-[5-ethylsulfonyl-2-(1,1,1-trifluoropropan-2-yloxy)benzoyl]-3-azabicyclo[3.1.0]hexane-1-carboximidamide (PubChem CID 123386666) has the molecular formula C18H22F3N3O4S and a molecular weight of 433.45 g/mol. Its IUPAC name is 3-[5-ethylsulfonyl-2-(1,1,1-trifluoropropan-2-yloxy)benzoyl]-3-azabicyclo[3.1.0]hexane-1-carboximidamide.
| Compound Name | 3-[5-ethylsulfonyl-2-(1,1,1-trifluoropropan-2-yloxy)benzoyl]-3-azabicyclo[3.1.0]hexane-1-carboximidamide |
|---|---|
| PubChem CID | 123386666 |
| Molecular Formula | C18H22F3N3O4S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 3-[5-ethylsulfonyl-2-(1,1,1-trifluoropropan-2-yloxy)benzoyl]-3-azabicyclo[3.1.0]hexane-1-carboximidamide |
| SMILES | [H]/N=C(\N)C12CC1CN(C(=O)c1cc(S(=O)(=O)CC)ccc1OC(C)C(F)(F)F)C2 |
| InChI | InChI=1S/C18H22F3N3O4S/c1-3-29(26,27)12-4-5-14(28-10(2)18(19,20)21)13(6-12)15(25)24-8-11-7-17(11,9-24)16(22)23/h4-6,10-11H,3,7-9H2,1-2H3,(H3,22,23) |
| InChIKey | VGIBGNWLLDBRCU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 113.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|