C17H20F3N3O5S — CID 123291197
N'-hydroxy-3-[5-methylsulfonyl-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxybenzoyl]-3-azabicyclo[3.1.0]hexane-1-carboximidamide (PubChem CID 123291197) has the molecular formula C17H20F3N3O5S and a molecular weight of 435.42 g/mol. Its IUPAC name is N'-hydroxy-3-[5-methylsulfonyl-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxybenzoyl]-3-azabicyclo[3.1.0]hexane-1-carboximidamide.
| Compound Name | N'-hydroxy-3-[5-methylsulfonyl-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxybenzoyl]-3-azabicyclo[3.1.0]hexane-1-carboximidamide |
|---|---|
| PubChem CID | 123291197 |
| Molecular Formula | C17H20F3N3O5S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N'-hydroxy-3-[5-methylsulfonyl-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxybenzoyl]-3-azabicyclo[3.1.0]hexane-1-carboximidamide |
| SMILES | C[C@@H](Oc1ccc(S(C)(=O)=O)cc1C(=O)N1CC2CC2(C(N)=NO)C1)C(F)(F)F |
| InChI | InChI=1S/C17H20F3N3O5S/c1-9(17(18,19)20)28-13-4-3-11(29(2,26)27)5-12(13)14(24)23-7-10-6-16(10,8-23)15(21)22-25/h3-5,9-10,25H,6-8H2,1-2H3,(H2,21,22)/t9-,10?,16?/m1/s1 |
| InChIKey | YIHISPCSRDRHQZ-PWGATLRDSA-N |
| XLogP | 1.63 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|