C11H10F3O5S- — CID 150772817
5-methylsulfonyl-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxybenzoate (PubChem CID 150772817) has the molecular formula C11H10F3O5S- and a molecular weight of 311.26 g/mol. Its IUPAC name is 5-methylsulfonyl-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxybenzoate.
| Compound Name | 5-methylsulfonyl-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 150772817 |
| Molecular Formula | C11H10F3O5S- |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 5-methylsulfonyl-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxybenzoate |
| SMILES | C[C@@H](Oc1ccc(S(C)(=O)=O)cc1C(=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C11H11F3O5S/c1-6(11(12,13)14)19-9-4-3-7(20(2,17)18)5-8(9)10(15)16/h3-6H,1-2H3,(H,15,16)/p-1/t6-/m1/s1 |
| InChIKey | KAFINIUNMPCGFL-ZCFIWIBFSA-M |
| XLogP | 0.78 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |