C22H30F2N2O2 — CID 123388163
2-[5-(1,1-difluoropropyl)cyclohexa-2,4-dien-1-yl]-2-hydroxy-N'-(3-phenylmethoxypropyl)propanimidamide (PubChem CID 123388163) has the molecular formula C22H30F2N2O2 and a molecular weight of 392.49 g/mol. Its IUPAC name is 2-[5-(1,1-difluoropropyl)cyclohexa-2,4-dien-1-yl]-2-hydroxy-N'-(3-phenylmethoxypropyl)propanimidamide.
| Compound Name | 2-[5-(1,1-difluoropropyl)cyclohexa-2,4-dien-1-yl]-2-hydroxy-N'-(3-phenylmethoxypropyl)propanimidamide |
|---|---|
| PubChem CID | 123388163 |
| Molecular Formula | C22H30F2N2O2 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-[5-(1,1-difluoropropyl)cyclohexa-2,4-dien-1-yl]-2-hydroxy-N'-(3-phenylmethoxypropyl)propanimidamide |
| SMILES | CCC(F)(F)C1=CC=CC(C(C)(O)/C(N)=N/CCCOCc2ccccc2)C1 |
| InChI | InChI=1S/C22H30F2N2O2/c1-3-22(23,24)19-12-7-11-18(15-19)21(2,27)20(25)26-13-8-14-28-16-17-9-5-4-6-10-17/h4-7,9-12,18,27H,3,8,13-16H2,1-2H3,(H2,25,26) |
| InChIKey | OSILTMWKNFSEGI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|