C13H30N2O — CID 123388278
4-(3-amino-2,3-dimethylbutoxy)-N,4-dimethylpentan-2-amine (PubChem CID 123388278) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is 4-(3-amino-2,3-dimethylbutoxy)-N,4-dimethylpentan-2-amine.
| Compound Name | 4-(3-amino-2,3-dimethylbutoxy)-N,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 123388278 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | 4-(3-amino-2,3-dimethylbutoxy)-N,4-dimethylpentan-2-amine |
| SMILES | CNC(C)CC(C)(C)OCC(C)C(C)(C)N |
| InChI | InChI=1S/C13H30N2O/c1-10(13(5,6)14)9-16-12(3,4)8-11(2)15-7/h10-11,15H,8-9,14H2,1-7H3 |
| InChIKey | RFIHKDGVRXNKHL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |