C12H13FN4OS — CID 123389016
4-[3-[(amino-methyl-oxo-λ6-sulfanylidene)methyl]-5-fluorophenyl]pyrimidin-2-amine (PubChem CID 123389016) has the molecular formula C12H13FN4OS and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-[3-[(amino-methyl-oxo-λ6-sulfanylidene)methyl]-5-fluorophenyl]pyrimidin-2-amine.
| Compound Name | 4-[3-[(amino-methyl-oxo-λ6-sulfanylidene)methyl]-5-fluorophenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 123389016 |
| Molecular Formula | C12H13FN4OS |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 4-[3-[(amino-methyl-oxo-λ6-sulfanylidene)methyl]-5-fluorophenyl]pyrimidin-2-amine |
| SMILES | CS(N)(=O)=Cc1cc(F)cc(-c2ccnc(N)n2)c1 |
| InChI | InChI=1S/C12H13FN4OS/c1-19(15,18)7-8-4-9(6-10(13)5-8)11-2-3-16-12(14)17-11/h2-7H,1H3,(H2,15,18)(H2,14,16,17) |
| InChIKey | ZKTHGOBJVYGQKP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|