C18H11F2N5O — CID 24746039
3-(2-aminopyrimidin-4-yl)-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine-7-carbaldehyde (PubChem CID 24746039) has the molecular formula C18H11F2N5O and a molecular weight of 351.32 g/mol. Its IUPAC name is 3-(2-aminopyrimidin-4-yl)-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine-7-carbaldehyde.
| Compound Name | 3-(2-aminopyrimidin-4-yl)-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine-7-carbaldehyde |
|---|---|
| PubChem CID | 24746039 |
| Molecular Formula | C18H11F2N5O |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 3-(2-aminopyrimidin-4-yl)-2-(2,4-difluorophenyl)imidazo[1,2-a]pyridine-7-carbaldehyde |
| SMILES | Nc1nccc(-c2c(-c3ccc(F)cc3F)nc3cc(C=O)ccn23)n1 |
| InChI | InChI=1S/C18H11F2N5O/c19-11-1-2-12(13(20)8-11)16-17(14-3-5-22-18(21)23-14)25-6-4-10(9-26)7-15(25)24-16/h1-9H,(H2,21,22,23) |
| InChIKey | CBTYHNRBULTEMQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|