C17H12FN5O3S — CID 58869534
2-(4-fluorophenyl)-3-(2-methylsulfonylpyrimidin-4-yl)-7-oxidoimidazo[1,2-a]pyrazin-7-ium (PubChem CID 58869534) has the molecular formula C17H12FN5O3S and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-(2-methylsulfonylpyrimidin-4-yl)-7-oxidoimidazo[1,2-a]pyrazin-7-ium.
| Compound Name | 2-(4-fluorophenyl)-3-(2-methylsulfonylpyrimidin-4-yl)-7-oxidoimidazo[1,2-a]pyrazin-7-ium |
|---|---|
| PubChem CID | 58869534 |
| Molecular Formula | C17H12FN5O3S |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-(4-fluorophenyl)-3-(2-methylsulfonylpyrimidin-4-yl)-7-oxidoimidazo[1,2-a]pyrazin-7-ium |
| SMILES | CS(=O)(=O)c1nccc(-c2c(-c3ccc(F)cc3)nc3c[n+]([O-])ccn23)n1 |
| InChI | InChI=1S/C17H12FN5O3S/c1-27(25,26)17-19-7-6-13(20-17)16-15(11-2-4-12(18)5-3-11)21-14-10-22(24)8-9-23(14)16/h2-10H,1H3 |
| InChIKey | GZGPDFNLZGZEBM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 104.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|