C31H30N2O4 — CID 123390258
ethyl (2S)-2-[6-isocyano-3-methyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 123390258) has the molecular formula C31H30N2O4 and a molecular weight of 494.59 g/mol. Its IUPAC name is ethyl (2S)-2-[6-isocyano-3-methyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | ethyl (2S)-2-[6-isocyano-3-methyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 123390258 |
| Molecular Formula | C31H30N2O4 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | ethyl (2S)-2-[6-isocyano-3-methyl-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | [C-]#[N+]c1ccc2c(-c3ccc4c5c(ccnc35)CCO4)c([C@H](OC(C)(C)C)C(=O)OCC)c(C)cc2c1 |
| InChI | InChI=1S/C31H30N2O4/c1-7-35-30(34)29(37-31(3,4)5)25-18(2)16-20-17-21(32-6)8-9-22(20)27(25)23-10-11-24-26-19(13-15-36-24)12-14-33-28(23)26/h8-12,14,16-17,29H,7,13,15H2,1-5H3/t29-/m0/s1 |
| InChIKey | JTZGBIRAAAFASI-LJAQVGFWSA-N |
| XLogP | 7.27 |
| TPSA | 62.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|